C20H22O6S2 — CID 59510758
1-[(1R)-2-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid (PubChem CID 59510758) has the molecular formula C20H22O6S2 and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-[(1R)-2-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid.
| Compound Name | 1-[(1R)-2-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 59510758 |
| Molecular Formula | C20H22O6S2 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-[(1R)-2-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1[C@H]1c3ccccc3CCC1S(=O)(=O)O)CCCC2 |
| InChI | InChI=1S/C20H22O6S2/c21-27(22,23)17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)28(24,25)26/h1,3,5,7,10,12,17,19H,2,4,6,8-9,11H2,(H,21,22,23)(H,24,25,26)/t17?,19-/m0/s1 |
| InChIKey | NHYQUNBPSAYLLR-NNBQYGFHSA-N |
| XLogP | 3.15 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|