C36H36NO2P — CID 142832734
(3R,4R)-1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl)-3,4-diphenylpyrrolidine (PubChem CID 142832734) has the molecular formula C36H36NO2P and a molecular weight of 545.66 g/mol. Its IUPAC name is (3R,4R)-1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl)-3,4-diphenylpyrrolidine.
| Compound Name | (3R,4R)-1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl)-3,4-diphenylpyrrolidine |
|---|---|
| PubChem CID | 142832734 |
| Molecular Formula | C36H36NO2P |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | (3R,4R)-1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),3,5,7,16,18(23)-hexaen-13-yl)-3,4-diphenylpyrrolidine |
| SMILES | c1ccc([C@@H]2CN(P3Oc4ccc5c(c4C4c6ccccc6CCC4O3)CCCC5)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C36H36NO2P/c1-3-11-25(12-4-1)31-23-37(24-32(31)26-13-5-2-6-14-26)40-38-33-21-19-27-15-7-9-17-29(27)35(33)36-30-18-10-8-16-28(30)20-22-34(36)39-40/h1-7,9,11-15,17,20,22,31-33,35H,8,10,16,18-19,21,23-24H2/t31-,32-,33?,35?,40?/m0/s1 |
| InChIKey | MLVAUQMZSAJNKZ-VFTRRHGXSA-N |
| XLogP | 8.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|