C20H20K2O6S2 — CID 140554354
dipotassium;1-[(1R,2R)-2-sulfonato-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonate (PubChem CID 140554354) has the molecular formula C20H20K2O6S2 and a molecular weight of 498.70 g/mol. Its IUPAC name is dipotassium;1-[(1R,2R)-2-sulfonato-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonate.
| Compound Name | dipotassium;1-[(1R,2R)-2-sulfonato-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 140554354 |
| Molecular Formula | C20H20K2O6S2 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | dipotassium;1-[(1R,2R)-2-sulfonato-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(c1[C@H]1c3ccccc3CC[C@H]1S(=O)(=O)[O-])CCCC2.[K+].[K+] |
| InChI | InChI=1S/C20H22O6S2.2K/c21-27(22,23)17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)28(24,25)26;;/h1,3,5,7,10,12,17,19H,2,4,6,8-9,11H2,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/t17-,19+;;/m1../s1 |
| InChIKey | URKNLCIXUXUDMW-QFZUCXBQSA-L |
| XLogP | -3.53 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|