C44H40OP2 — CID 134863950
[1-[(1S,2S)-2-diphenylphosphoryl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]-diphenylphosphane (PubChem CID 134863950) has the molecular formula C44H40OP2 and a molecular weight of 646.75 g/mol. Its IUPAC name is [1-[(1S,2S)-2-diphenylphosphoryl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]-diphenylphosphane.
| Compound Name | [1-[(1S,2S)-2-diphenylphosphoryl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 134863950 |
| Molecular Formula | C44H40OP2 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | [1-[(1S,2S)-2-diphenylphosphoryl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]-diphenylphosphane |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@H]1CCc2ccccc2[C@H]1c1c(P(c2ccccc2)c2ccccc2)ccc2c1CCCC2 |
| InChI | InChI=1S/C44H40OP2/c45-47(37-23-9-3-10-24-37,38-25-11-4-12-26-38)42-32-30-34-18-14-16-28-40(34)44(42)43-39-27-15-13-17-33(39)29-31-41(43)46(35-19-5-1-6-20-35)36-21-7-2-8-22-36/h1-12,14,16,18-26,28-29,31,42,44H,13,15,17,27,30,32H2/t42-,44+/m0/s1 |
| InChIKey | LSACMYCARVUGBA-KOHORPAVSA-N |
| XLogP | 8.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|