C34H31NP2 — CID 71608542
(1R)-N,8-bis(diphenylphosphanyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 71608542) has the molecular formula C34H31NP2 and a molecular weight of 515.58 g/mol. Its IUPAC name is (1R)-N,8-bis(diphenylphosphanyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-N,8-bis(diphenylphosphanyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 71608542 |
| Molecular Formula | C34H31NP2 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | (1R)-N,8-bis(diphenylphosphanyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | c1ccc(P(N[C@@H]2CCCc3cccc(P(c4ccccc4)c4ccccc4)c32)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H31NP2/c1-5-17-28(18-6-1)36(29-19-7-2-8-20-29)33-26-14-16-27-15-13-25-32(34(27)33)35-37(30-21-9-3-10-22-30)31-23-11-4-12-24-31/h1-12,14,16-24,26,32,35H,13,15,25H2/t32-/m1/s1 |
| InChIKey | OKAIVAPYJUIWCQ-JGCGQSQUSA-N |
| XLogP | 6.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|