C32H36NP — CID 132532385
N-[(1R)-8-diphenylphosphanyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 132532385) has the molecular formula C32H36NP and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[(1R)-8-diphenylphosphanyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | N-[(1R)-8-diphenylphosphanyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 132532385 |
| Molecular Formula | C32H36NP |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[(1R)-8-diphenylphosphanyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CC12CCC(C/C1=N\[C@@H]1CCCc3cccc(P(c4ccccc4)c4ccccc4)c31)C2(C)C |
| InChI | InChI=1S/C32H36NP/c1-31(2)24-20-21-32(31,3)29(22-24)33-27-18-10-12-23-13-11-19-28(30(23)27)34(25-14-6-4-7-15-25)26-16-8-5-9-17-26/h4-9,11,13-17,19,24,27H,10,12,18,20-22H2,1-3H3/b33-29+/t24?,27-,32?/m1/s1 |
| InChIKey | PHKJOXZHFBQFOG-JXRVLUEKSA-N |
| XLogP | 7.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|