C26H34N4O4 — CID 59424253
(2E,4E)-2-acetyl-N-[4-[[(2Z,4E)-2-acetyl-5-(dimethylamino)-3-methylpenta-2,4-dienoyl]amino]phenyl]-5-(dimethylamino)-3-methylpenta-2,4-dienamide (PubChem CID 59424253) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is (2E,4E)-2-acetyl-N-[4-[[(2Z,4E)-2-acetyl-5-(dimethylamino)-3-methylpenta-2,4-dienoyl]amino]phenyl]-5-(dimethylamino)-3-methylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-2-acetyl-N-[4-[[(2Z,4E)-2-acetyl-5-(dimethylamino)-3-methylpenta-2,4-dienoyl]amino]phenyl]-5-(dimethylamino)-3-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 59424253 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (2E,4E)-2-acetyl-N-[4-[[(2Z,4E)-2-acetyl-5-(dimethylamino)-3-methylpenta-2,4-dienoyl]amino]phenyl]-5-(dimethylamino)-3-methylpenta-2,4-dienamide |
| SMILES | CC(=O)/C(C(=O)Nc1ccc(NC(=O)/C(C(C)=O)=C(C)/C=C/N(C)C)cc1)=C(C)/C=C/N(C)C |
| InChI | InChI=1S/C26H34N4O4/c1-17(13-15-29(5)6)23(19(3)31)25(33)27-21-9-11-22(12-10-21)28-26(34)24(20(4)32)18(2)14-16-30(7)8/h9-16H,1-8H3,(H,27,33)(H,28,34)/b15-13+,16-14+,23-17-,24-18+ |
| InChIKey | KTWXLZUJSJAGDE-CMFCZBAZSA-N |
| XLogP | 3.53 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|