C26H26N2O6S2 — CID 59424895
(3aR,6aR)-1-[4-[4-(benzenesulfonamido)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid (PubChem CID 59424895) has the molecular formula C26H26N2O6S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is (3aR,6aR)-1-[4-[4-(benzenesulfonamido)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid.
| Compound Name | (3aR,6aR)-1-[4-[4-(benzenesulfonamido)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 59424895 |
| Molecular Formula | C26H26N2O6S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | (3aR,6aR)-1-[4-[4-(benzenesulfonamido)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)C1C[C@H]2CCC[C@H]2N1S(=O)(=O)c1ccc(-c2ccc(NS(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O6S2/c29-26(30)25-17-20-5-4-8-24(20)28(25)36(33,34)23-15-11-19(12-16-23)18-9-13-21(14-10-18)27-35(31,32)22-6-2-1-3-7-22/h1-3,6-7,9-16,20,24-25,27H,4-5,8,17H2,(H,29,30)/t20-,24-,25?/m1/s1 |
| InChIKey | ZABJYSSMCFSACE-XPTUZCQZSA-N |
| XLogP | 4.17 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |