C25H28N2O7S — CID 68535094
[1-[4-[4-(cyclopropylmethoxycarbonylamino)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl] hydrogen carbonate (PubChem CID 68535094) has the molecular formula C25H28N2O7S and a molecular weight of 500.57 g/mol. Its IUPAC name is [1-[4-[4-(cyclopropylmethoxycarbonylamino)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl] hydrogen carbonate.
| Compound Name | [1-[4-[4-(cyclopropylmethoxycarbonylamino)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68535094 |
| Molecular Formula | C25H28N2O7S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | [1-[4-[4-(cyclopropylmethoxycarbonylamino)phenyl]phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)OC1CC2CCCC2N1S(=O)(=O)c1ccc(-c2ccc(NC(=O)OCC3CC3)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O7S/c28-24(33-15-16-4-5-16)26-20-10-6-17(7-11-20)18-8-12-21(13-9-18)35(31,32)27-22-3-1-2-19(22)14-23(27)34-25(29)30/h6-13,16,19,22-23H,1-5,14-15H2,(H,26,28)(H,29,30) |
| InChIKey | XACQGZWPYJXMMD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |