About (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane
(7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane (PubChem CID 59427339) has the molecular formula C10H12ClNOSi
and a molecular weight of 225.75 g/mol. Its IUPAC name is (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane.
Molecular Properties
| Compound Name | (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane |
| PubChem CID | 59427339 |
| Molecular Formula | C10H12ClNOSi |
| Molecular Weight | 225.75 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc2nccc(Cl)c2o1 |
| InChI | InChI=1S/C10H12ClNOSi/c1-14(2,3)9-6-8-10(13-9)7(11)4-5-12-8/h4-6H,1-3H3 |
| InChIKey | AYTYKFMMCYBPDB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.75 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane?
The IUPAC name of (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane (CID 59427339) is (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane.
What is the SMILES notation for (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane?
The canonical SMILES for (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane is C[Si](C)(C)c1cc2nccc(Cl)c2o1.
What is the InChIKey of (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane?
The InChIKey is AYTYKFMMCYBPDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNOSi/c1-14(2,3)9-6-8-10(13-9)7(11)4-5-12-8/h4-6H,1-3H3.
What are the key properties of (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane?
(7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane has a molecular weight of 225.75 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane is sourced from PubChem (CID 59427339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).