C32H54BrN7O4Si2 — CID 59427789
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 59427789) has the molecular formula C32H54BrN7O4Si2 and a molecular weight of 736.91 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59427789 |
| Molecular Formula | C32H54BrN7O4Si2 |
| Molecular Weight | 736.91 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | Cn1cc(-c2cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c(Br)c(C4CCCN(C(=O)OC(C)(C)C)C4)nc23)cn1 |
| InChI | InChI=1S/C32H54BrN7O4Si2/c1-32(2,3)44-31(41)38-13-11-12-24(21-38)28-27(33)30(40-29(36-28)26(19-35-40)25-18-34-37(4)20-25)39(22-42-14-16-45(5,6)7)23-43-15-17-46(8,9)10/h18-20,24H,11-17,21-23H2,1-10H3 |
| InChIKey | AIEQSZZQLUUAGA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 99.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.91 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|