C26H45N7O2Si2 — CID 71199054
3-(1-methylpyrazol-4-yl)-5-pyrrolidin-1-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71199054) has the molecular formula C26H45N7O2Si2 and a molecular weight of 543.87 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-5-pyrrolidin-1-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-(1-methylpyrazol-4-yl)-5-pyrrolidin-1-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71199054 |
| Molecular Formula | C26H45N7O2Si2 |
| Molecular Weight | 543.87 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-5-pyrrolidin-1-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cn1cc(-c2cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(N4CCCC4)nc23)cn1 |
| InChI | InChI=1S/C26H45N7O2Si2/c1-30-19-22(17-27-30)23-18-28-33-25(16-24(29-26(23)33)31-10-8-9-11-31)32(20-34-12-14-36(2,3)4)21-35-13-15-37(5,6)7/h16-19H,8-15,20-21H2,1-7H3 |
| InChIKey | INTDDDXBKMMWMP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.87 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|