C27H41N3O5 — CID 59432718
[(3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-[4-(ethenylideneamino)butyl]carbamate (PubChem CID 59432718) has the molecular formula C27H41N3O5 and a molecular weight of 487.64 g/mol. Its IUPAC name is [(3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-[4-(ethenylideneamino)butyl]carbamate.
| Compound Name | [(3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-[4-(ethenylideneamino)butyl]carbamate |
|---|---|
| PubChem CID | 59432718 |
| Molecular Formula | C27H41N3O5 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | [(3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-[4-(ethenylideneamino)butyl]carbamate |
| SMILES | C=C=NCCCCNC(=O)O[C@@H]1CCN([C@@H]2CCCC[C@H]2OCCc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C27H41N3O5/c1-4-28-15-7-8-16-29-27(31)35-22-13-17-30(20-22)23-9-5-6-10-24(23)34-18-14-21-11-12-25(32-2)26(19-21)33-3/h11-12,19,22-24H,1,5-10,13-18,20H2,2-3H3,(H,29,31)/t22-,23-,24-/m1/s1 |
| InChIKey | SPHFHNOFDXQCLH-WXFUMESZSA-N |
| XLogP | 4.01 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|