C25H39BrN2O5 — CID 89040207
[1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-(4-bromobutyl)carbamate (PubChem CID 89040207) has the molecular formula C25H39BrN2O5 and a molecular weight of 527.50 g/mol. Its IUPAC name is [1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-(4-bromobutyl)carbamate.
| Compound Name | [1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-(4-bromobutyl)carbamate |
|---|---|
| PubChem CID | 89040207 |
| Molecular Formula | C25H39BrN2O5 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | [1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl] N-(4-bromobutyl)carbamate |
| SMILES | COc1ccc(CCO[C@@H]2CCCC[C@H]2N2CCC(OC(=O)NCCCCBr)C2)cc1OC |
| InChI | InChI=1S/C25H39BrN2O5/c1-30-23-10-9-19(17-24(23)31-2)12-16-32-22-8-4-3-7-21(22)28-15-11-20(18-28)33-25(29)27-14-6-5-13-26/h9-10,17,20-22H,3-8,11-16,18H2,1-2H3,(H,27,29)/t20?,21-,22-/m1/s1 |
| InChIKey | FDCHTUQEYZXOQB-HRUVVLKGSA-N |
| XLogP | 4.55 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|