C30H48N2O9S — CID 87352772
2-[[7-[(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxy-7-oxoheptanoyl]-methylamino]ethanesulfonic acid (PubChem CID 87352772) has the molecular formula C30H48N2O9S and a molecular weight of 612.79 g/mol. Its IUPAC name is 2-[[7-[(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxy-7-oxoheptanoyl]-methylamino]ethanesulfonic acid.
| Compound Name | 2-[[7-[(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxy-7-oxoheptanoyl]-methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87352772 |
| Molecular Formula | C30H48N2O9S |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 2-[[7-[(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxy-7-oxoheptanoyl]-methylamino]ethanesulfonic acid |
| SMILES | COc1ccc(CCO[C@H]2CCCC[C@H]2N2CC[C@H](OC(=O)CCCCCC(=O)N(C)CCS(=O)(=O)O)C2)cc1OC |
| InChI | InChI=1S/C30H48N2O9S/c1-31(18-20-42(35,36)37)29(33)11-5-4-6-12-30(34)41-24-15-17-32(22-24)25-9-7-8-10-26(25)40-19-16-23-13-14-27(38-2)28(21-23)39-3/h13-14,21,24-26H,4-12,15-20,22H2,1-3H3,(H,35,36,37)/t24-,25+,26-/m0/s1 |
| InChIKey | NBBAKFLUMBSDEU-NXCFDTQHSA-N |
| XLogP | 3.49 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|