C21H34NO8P — CID 67314911
[(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxymethyl dihydrogen phosphate (PubChem CID 67314911) has the molecular formula C21H34NO8P and a molecular weight of 459.48 g/mol. Its IUPAC name is [(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 67314911 |
| Molecular Formula | C21H34NO8P |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | [(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-yl]oxymethyl dihydrogen phosphate |
| SMILES | COc1ccc(CCO[C@H]2CCCC[C@H]2N2CC[C@H](OCOP(=O)(O)O)C2)cc1OC |
| InChI | InChI=1S/C21H34NO8P/c1-26-20-8-7-16(13-21(20)27-2)10-12-28-19-6-4-3-5-18(19)22-11-9-17(14-22)29-15-30-31(23,24)25/h7-8,13,17-19H,3-6,9-12,14-15H2,1-2H3,(H2,23,24,25)/t17-,18+,19-/m0/s1 |
| InChIKey | QWAKTUORTSLTRS-OTWHNJEPSA-N |
| XLogP | 2.73 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|