C26H33N3O3 — CID 59433350
but-3-ynyl 3-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 59433350) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is but-3-ynyl 3-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | but-3-ynyl 3-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 59433350 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | but-3-ynyl 3-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C#CCCOC(=O)N1C2CCC1CC(N1CCC3(CC1)CN(C(C)=O)c1ccccc13)C2 |
| InChI | InChI=1S/C26H33N3O3/c1-3-4-15-32-25(31)29-20-9-10-21(29)17-22(16-20)27-13-11-26(12-14-27)18-28(19(2)30)24-8-6-5-7-23(24)26/h1,5-8,20-22H,4,9-18H2,2H3 |
| InChIKey | LXRYYXLMCFORPB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|