C18H16FN3 — CID 59435439
6-(2-fluorophenyl)-1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindole (PubChem CID 59435439) has the molecular formula C18H16FN3 and a molecular weight of 293.35 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindole.
| Compound Name | 6-(2-fluorophenyl)-1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 59435439 |
| Molecular Formula | C18H16FN3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 6-(2-fluorophenyl)-1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindole |
| SMILES | Fc1ccccc1-c1ccc2c(c1)N(Cc1cnc[nH]1)CC2 |
| InChI | InChI=1S/C18H16FN3/c19-17-4-2-1-3-16(17)14-6-5-13-7-8-22(18(13)9-14)11-15-10-20-12-21-15/h1-6,9-10,12H,7-8,11H2,(H,20,21) |
| InChIKey | VPOLERCHDYEPOR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |