C20H16Cl2N4O2 — CID 59436109
6-[2,6-dichloro-4-(2-hydroxypropan-2-yl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one (PubChem CID 59436109) has the molecular formula C20H16Cl2N4O2 and a molecular weight of 415.28 g/mol. Its IUPAC name is 6-[2,6-dichloro-4-(2-hydroxypropan-2-yl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one.
| Compound Name | 6-[2,6-dichloro-4-(2-hydroxypropan-2-yl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
|---|---|
| PubChem CID | 59436109 |
| Molecular Formula | C20H16Cl2N4O2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 6-[2,6-dichloro-4-(2-hydroxypropan-2-yl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
| SMILES | CC(C)(O)c1cc(Cl)c(Nc2nc3ccncc3c3c(=O)[nH]ccc23)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N4O2/c1-20(2,28)10-7-13(21)17(14(22)8-10)26-18-11-3-6-24-19(27)16(11)12-9-23-5-4-15(12)25-18/h3-9,28H,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | GQLLFQLMJSBBNK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|