C16H15F3N6O2 — CID 59437528
N-[5-(3-hydroxypropylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide (PubChem CID 59437528) has the molecular formula C16H15F3N6O2 and a molecular weight of 380.33 g/mol. Its IUPAC name is N-[5-(3-hydroxypropylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[5-(3-hydroxypropylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59437528 |
| Molecular Formula | C16H15F3N6O2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[5-(3-hydroxypropylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc2cc(C(F)(F)F)cc(NCCCO)n2n1)c1cccnc1 |
| InChI | InChI=1S/C16H15F3N6O2/c17-16(18,19)11-7-12(21-5-2-6-26)25-13(8-11)22-15(24-25)23-14(27)10-3-1-4-20-9-10/h1,3-4,7-9,21,26H,2,5-6H2,(H,23,24,27) |
| InChIKey | SPPCIFKCMMXPEE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|