C10H6NO2S+ — CID 59438315
2-(cyclohexatrienyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 59438315) has the molecular formula C10H6NO2S+ and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(cyclohexatrienyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(cyclohexatrienyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 59438315 |
| Molecular Formula | C10H6NO2S+ |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 2-(cyclohexatrienyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C2=CC=C[C+]=C2)n1 |
| InChI | InChI=1S/C10H5NO2S/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-2,4-6H/p+1 |
| InChIKey | IBNZNBXVRCDPIG-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|