C16H19ClN4O2S2 — CID 59438799
N-[[5-[(E)-but-2-enyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-chlorobenzenesulfonamide (PubChem CID 59438799) has the molecular formula C16H19ClN4O2S2 and a molecular weight of 398.94 g/mol. Its IUPAC name is N-[[5-[(E)-but-2-enyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[[5-[(E)-but-2-enyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 59438799 |
| Molecular Formula | C16H19ClN4O2S2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-[[5-[(E)-but-2-enyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-chlorobenzenesulfonamide |
| SMILES | C=CCn1c(CNS(=O)(=O)c2ccc(Cl)cc2)nnc1SC/C=C/C |
| InChI | InChI=1S/C16H19ClN4O2S2/c1-3-5-11-24-16-20-19-15(21(16)10-4-2)12-18-25(22,23)14-8-6-13(17)7-9-14/h3-9,18H,2,10-12H2,1H3/b5-3+ |
| InChIKey | WLHBSSNBLARONF-HWKANZROSA-N |
| XLogP | 3.26 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|