C9H14NW- — CID 59439322
[(Z)-5-(methanidylideneamino)-2,2-dimethylhex-4-en-3-ylidene]tungsten (PubChem CID 59439322) has the molecular formula C9H14NW- and a molecular weight of 320.06 g/mol. Its IUPAC name is [(Z)-5-(methanidylideneamino)-2,2-dimethylhex-4-en-3-ylidene]tungsten.
| Compound Name | [(Z)-5-(methanidylideneamino)-2,2-dimethylhex-4-en-3-ylidene]tungsten |
|---|---|
| PubChem CID | 59439322 |
| Molecular Formula | C9H14NW- |
| Molecular Weight | 320.06 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | [(Z)-5-(methanidylideneamino)-2,2-dimethylhex-4-en-3-ylidene]tungsten |
| SMILES | [H]/[C-]=N/C(C)=C\C(=[W])C(C)(C)C |
| InChI | InChI=1S/C9H14N.W/c1-8(10-5)6-7-9(2,3)4;/h5-6H,1-4H3;/q-1;/b8-6-; |
| InChIKey | WCHMPWHYZFQUCQ-PHZXCRFESA-N |
| XLogP | 2.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.06 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|