C17H19NO6S — CID 59445895
(3S,4S)-4-(4-acetylphenyl)-3-(2-ethoxy-2-oxoethyl)-2-oxo-3,4-dihydropyridine-1-sulfinic acid (PubChem CID 59445895) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is (3S,4S)-4-(4-acetylphenyl)-3-(2-ethoxy-2-oxoethyl)-2-oxo-3,4-dihydropyridine-1-sulfinic acid.
| Compound Name | (3S,4S)-4-(4-acetylphenyl)-3-(2-ethoxy-2-oxoethyl)-2-oxo-3,4-dihydropyridine-1-sulfinic acid |
|---|---|
| PubChem CID | 59445895 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (3S,4S)-4-(4-acetylphenyl)-3-(2-ethoxy-2-oxoethyl)-2-oxo-3,4-dihydropyridine-1-sulfinic acid |
| SMILES | CCOC(=O)C[C@@H]1C(=O)N(S(=O)O)C=C[C@@H]1c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C17H19NO6S/c1-3-24-16(20)10-15-14(8-9-18(17(15)21)25(22)23)13-6-4-12(5-7-13)11(2)19/h4-9,14-15H,3,10H2,1-2H3,(H,22,23)/t14-,15+/m1/s1 |
| InChIKey | RQJZOZJWCHRQGC-CABCVRRESA-N |
| XLogP | 2.03 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|