C12H24N2O2 — CID 59446093
2-(tert-butylamino)-1-methoxyimino-4,4-dimethylpentan-3-one (PubChem CID 59446093) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-methoxyimino-4,4-dimethylpentan-3-one.
| Compound Name | 2-(tert-butylamino)-1-methoxyimino-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 59446093 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-(tert-butylamino)-1-methoxyimino-4,4-dimethylpentan-3-one |
| SMILES | CON=CC(NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-11(2,3)10(15)9(8-13-16-7)14-12(4,5)6/h8-9,14H,1-7H3 |
| InChIKey | AMNYRTOJVCJZRF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|