C10H22N2O — CID 59447973
(2,6-dimethyl-4-propan-2-ylmorpholin-3-yl)methanamine (PubChem CID 59447973) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (2,6-dimethyl-4-propan-2-ylmorpholin-3-yl)methanamine.
| Compound Name | (2,6-dimethyl-4-propan-2-ylmorpholin-3-yl)methanamine |
|---|---|
| PubChem CID | 59447973 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2,6-dimethyl-4-propan-2-ylmorpholin-3-yl)methanamine |
| SMILES | CC1CN(C(C)C)C(CN)C(C)O1 |
| InChI | InChI=1S/C10H22N2O/c1-7(2)12-6-8(3)13-9(4)10(12)5-11/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | BZOFGTASMZAHND-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |