C27H18N3NaO6S2 — CID 59449354
sodium [1-(7-oxidoperoxysulfanylbenzo[e]benzotriazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate (PubChem CID 59449354) has the molecular formula C27H18N3NaO6S2 and a molecular weight of 567.58 g/mol. Its IUPAC name is sodium [1-(7-oxidoperoxysulfanylbenzo[e]benzotriazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate.
| Compound Name | sodium [1-(7-oxidoperoxysulfanylbenzo[e]benzotriazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59449354 |
| Molecular Formula | C27H18N3NaO6S2 |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | sodium [1-(7-oxidoperoxysulfanylbenzo[e]benzotriazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3ccccc3c2-n2nc3ccc4cc(SOO[O-])ccc4c3n2)cc1.[Na+] |
| InChI | InChI=1S/C27H19N3O6S2.Na/c1-17-6-11-21(12-7-17)38(32,33)34-25-15-9-18-4-2-3-5-23(18)27(25)30-28-24-14-8-19-16-20(37-36-35-31)10-13-22(19)26(24)29-30;/h2-16,31H,1H3;/q;+1/p-1 |
| InChIKey | JEBFKZRJXMQQSM-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 115.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|