C32H22N2O3S — CID 59449287
[1-(1H-phenanthro[9,10-d]imidazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate (PubChem CID 59449287) has the molecular formula C32H22N2O3S and a molecular weight of 514.61 g/mol. Its IUPAC name is [1-(1H-phenanthro[9,10-d]imidazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-(1H-phenanthro[9,10-d]imidazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59449287 |
| Molecular Formula | C32H22N2O3S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | [1-(1H-phenanthro[9,10-d]imidazol-2-yl)naphthalen-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3ccccc3c2-c2nc3c4ccccc4c4ccccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C32H22N2O3S/c1-20-14-17-22(18-15-20)38(35,36)37-28-19-16-21-8-2-3-9-23(21)29(28)32-33-30-26-12-6-4-10-24(26)25-11-5-7-13-27(25)31(30)34-32/h2-19H,1H3,(H,33,34) |
| InChIKey | QUMIIIZOCRRCKC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|