C24H19NO3S — CID 135271333
(1,7-dimethyl-9H-carbazol-2-yl) naphthalene-1-sulfonate (PubChem CID 135271333) has the molecular formula C24H19NO3S and a molecular weight of 401.49 g/mol. Its IUPAC name is (1,7-dimethyl-9H-carbazol-2-yl) naphthalene-1-sulfonate.
| Compound Name | (1,7-dimethyl-9H-carbazol-2-yl) naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 135271333 |
| Molecular Formula | C24H19NO3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (1,7-dimethyl-9H-carbazol-2-yl) naphthalene-1-sulfonate |
| SMILES | Cc1ccc2c(c1)[nH]c1c(C)c(OS(=O)(=O)c3cccc4ccccc34)ccc12 |
| InChI | InChI=1S/C24H19NO3S/c1-15-10-11-19-20-12-13-22(16(2)24(20)25-21(19)14-15)28-29(26,27)23-9-5-7-17-6-3-4-8-18(17)23/h3-14,25H,1-2H3 |
| InChIKey | YHRPDYVHXMCOIZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|