C46H31N3O7S2 — CID 59449340
[5-benzo[g][1,3]benzoxazol-2-yl-4-(4-methylphenyl)sulfonyloxy-2-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 59449340) has the molecular formula C46H31N3O7S2 and a molecular weight of 801.90 g/mol. Its IUPAC name is [5-benzo[g][1,3]benzoxazol-2-yl-4-(4-methylphenyl)sulfonyloxy-2-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [5-benzo[g][1,3]benzoxazol-2-yl-4-(4-methylphenyl)sulfonyloxy-2-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59449340 |
| Molecular Formula | C46H31N3O7S2 |
| Molecular Weight | 801.90 g/mol |
| Exact Mass | 801.16 |
| IUPAC Name | [5-benzo[g][1,3]benzoxazol-2-yl-4-(4-methylphenyl)sulfonyloxy-2-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(-c3nc4ccc5ccccc5c4o3)c(OS(=O)(=O)c3ccc(C)cc3)cc2-c2nc3c4ccccc4c4ccccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C46H31N3O7S2/c1-27-15-20-30(21-16-27)57(50,51)55-40-26-38(46-47-39-24-19-29-9-3-4-10-32(29)44(39)54-46)41(56-58(52,53)31-22-17-28(2)18-23-31)25-37(40)45-48-42-35-13-7-5-11-33(35)34-12-6-8-14-36(34)43(42)49-45/h3-26H,1-2H3,(H,48,49) |
| InChIKey | GTQNGCZSEWSZDM-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.90 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|