C30H20BN3O2S — CID 89277493
CID 89277493 (PubChem CID 89277493) has the molecular formula C30H20BN3O2S and a molecular weight of 497.39 g/mol.
| Compound Name | CID 89277493 |
|---|---|
| PubChem CID | 89277493 |
| Molecular Formula | C30H20BN3O2S |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c(-c1nc3c4ccccc4c4ccccc4c3[nH]1)cn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H20BN3O2S/c1-18-10-13-20(14-11-18)37(35,36)34-17-26(25-16-19(31)12-15-27(25)34)30-32-28-23-8-4-2-6-21(23)22-7-3-5-9-24(22)29(28)33-30/h2-17H,1H3,(H,32,33) |
| InChIKey | RBUCOPMSMLATGO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|