C34H25N5O2S — CID 101145362
3-benzyl-8-[1-(4-methylphenyl)sulfonylindol-3-yl]-3,5,7,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),4,7,11,13,15-heptaene (PubChem CID 101145362) has the molecular formula C34H25N5O2S and a molecular weight of 567.67 g/mol. Its IUPAC name is 3-benzyl-8-[1-(4-methylphenyl)sulfonylindol-3-yl]-3,5,7,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),4,7,11,13,15-heptaene.
| Compound Name | 3-benzyl-8-[1-(4-methylphenyl)sulfonylindol-3-yl]-3,5,7,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),4,7,11,13,15-heptaene |
|---|---|
| PubChem CID | 101145362 |
| Molecular Formula | C34H25N5O2S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 3-benzyl-8-[1-(4-methylphenyl)sulfonylindol-3-yl]-3,5,7,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),4,7,11,13,15-heptaene |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3nc4ncn(Cc5ccccc5)c4c4c3[nH]c3ccccc34)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H25N5O2S/c1-22-15-17-24(18-16-22)42(40,41)39-20-27(25-11-6-8-14-29(25)39)31-32-30(26-12-5-7-13-28(26)36-32)33-34(37-31)35-21-38(33)19-23-9-3-2-4-10-23/h2-18,20-21,36H,19H2,1H3 |
| InChIKey | VIKNJXQXVZNBPT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |