C31H31N2O4+ — CID 59449444
ethyl 2-[2-[[(3Z)-3-[(1-ethylquinolin-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]acetate (PubChem CID 59449444) has the molecular formula C31H31N2O4+ and a molecular weight of 495.60 g/mol. Its IUPAC name is ethyl 2-[2-[[(3Z)-3-[(1-ethylquinolin-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[[(3Z)-3-[(1-ethylquinolin-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]acetate |
|---|---|
| PubChem CID | 59449444 |
| Molecular Formula | C31H31N2O4+ |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | ethyl 2-[2-[[(3Z)-3-[(1-ethylquinolin-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=CC2=C(O)/C(=C/c3ccc4ccccc4[n+]3CC)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H30N2O4/c1-5-32-21(16-15-20-11-7-9-13-25(20)32)17-22-29(35)23(30(22)36)18-27-31(3,4)24-12-8-10-14-26(24)33(27)19-28(34)37-6-2/h7-18H,5-6,19H2,1-4H3/p+1 |
| InChIKey | LUEOBBDQUWVZHQ-UHFFFAOYSA-O |
| XLogP | 5.17 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|