C28H31N5O — CID 59452388
4-[2-(1H-indol-3-yl)ethyl]-1'-methyl-N-pyridin-4-ylspiro[3H-1,4-benzoxazine-2,4'-piperidine]-7-amine (PubChem CID 59452388) has the molecular formula C28H31N5O and a molecular weight of 453.59 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-yl)ethyl]-1'-methyl-N-pyridin-4-ylspiro[3H-1,4-benzoxazine-2,4'-piperidine]-7-amine.
| Compound Name | 4-[2-(1H-indol-3-yl)ethyl]-1'-methyl-N-pyridin-4-ylspiro[3H-1,4-benzoxazine-2,4'-piperidine]-7-amine |
|---|---|
| PubChem CID | 59452388 |
| Molecular Formula | C28H31N5O |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 4-[2-(1H-indol-3-yl)ethyl]-1'-methyl-N-pyridin-4-ylspiro[3H-1,4-benzoxazine-2,4'-piperidine]-7-amine |
| SMILES | CN1CCC2(CC1)CN(CCc1c[nH]c3ccccc13)c1ccc(Nc3ccncc3)cc1O2 |
| InChI | InChI=1S/C28H31N5O/c1-32-16-11-28(12-17-32)20-33(15-10-21-19-30-25-5-3-2-4-24(21)25)26-7-6-23(18-27(26)34-28)31-22-8-13-29-14-9-22/h2-9,13-14,18-19,30H,10-12,15-17,20H2,1H3,(H,29,31) |
| InChIKey | YDAKRQRJERQMOG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|