C28H33N3O5 — CID 59454074
cis-phenacyl (1R,2S)-2-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylate (PubChem CID 59454074) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is cis-phenacyl (1R,2S)-2-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylate.
| Compound Name | cis-phenacyl (1R,2S)-2-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 59454074 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | cis-phenacyl (1R,2S)-2-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylate |
| SMILES | CCCC[C@H](NC(=O)/C=C/c1ccccn1)C(=O)N[C@H]1CCC[C@H]1C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O5/c1-2-3-14-24(30-26(33)17-16-21-12-7-8-18-29-21)27(34)31-23-15-9-13-22(23)28(35)36-19-25(32)20-10-5-4-6-11-20/h4-8,10-12,16-18,22-24H,2-3,9,13-15,19H2,1H3,(H,30,33)(H,31,34)/b17-16+/t22-,23+,24+/m1/s1 |
| InChIKey | GSTHWAWGLLUBEN-QAYXJGBGSA-N |
| XLogP | 3.48 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|