C21H28N2O5 — CID 59454117
cis-(1R,2S)-2-[[(2S)-2-[[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 59454117) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[(2S)-2-[[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[[(2S)-2-[[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 59454117 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | cis-(1R,2S)-2-[[(2S)-2-[[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]amino]hexanoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CCCC[C@H](NC(=O)/C=C/c1cccc(O)c1)C(=O)N[C@H]1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H28N2O5/c1-2-3-9-18(20(26)23-17-10-5-8-16(17)21(27)28)22-19(25)12-11-14-6-4-7-15(24)13-14/h4,6-7,11-13,16-18,24H,2-3,5,8-10H2,1H3,(H,22,25)(H,23,26)(H,27,28)/b12-11+/t16-,17+,18+/m1/s1 |
| InChIKey | VHGVREJOYSNSGM-NIQVOTFSSA-N |
| XLogP | 2.45 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|