About (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate
(3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate (PubChem CID 59460099) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate |
| PubChem CID | 59460099 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1OC(=O)C(C)C1C |
| InChI | InChI=1S/C10H14O4/c1-5(2)8(11)13-10-7(4)6(3)9(12)14-10/h6-7,10H,1H2,2-4H3 |
| InChIKey | RATIBSDSQZRRQT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate?
The IUPAC name of (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate (CID 59460099) is (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate.
What is the SMILES notation for (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate?
The canonical SMILES for (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate is C=C(C)C(=O)OC1OC(=O)C(C)C1C.
What is the InChIKey of (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate?
The InChIKey is RATIBSDSQZRRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-5(2)8(11)13-10-7(4)6(3)9(12)14-10/h6-7,10H,1H2,2-4H3.
What are the key properties of (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate?
(3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate has a molecular weight of 198.22 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethyl-5-oxooxolan-2-yl) 2-methylprop-2-enoate is sourced from PubChem (CID 59460099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).