About 2H-oxet-2-yl 2-methylprop-2-enoate
2H-oxet-2-yl 2-methylprop-2-enoate (PubChem CID 172735399) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 2H-oxet-2-yl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2H-oxet-2-yl 2-methylprop-2-enoate |
| PubChem CID | 172735399 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 2H-oxet-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C=CO1 |
| InChI | InChI=1S/C7H8O3/c1-5(2)7(8)10-6-3-4-9-6/h3-4,6H,1H2,2H3 |
| InChIKey | IJBHCCJNJFUUGE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2H-oxet-2-yl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-oxet-2-yl 2-methylprop-2-enoate?
The IUPAC name of 2H-oxet-2-yl 2-methylprop-2-enoate (CID 172735399) is 2H-oxet-2-yl 2-methylprop-2-enoate.
What is the SMILES notation for 2H-oxet-2-yl 2-methylprop-2-enoate?
The canonical SMILES for 2H-oxet-2-yl 2-methylprop-2-enoate is C=C(C)C(=O)OC1C=CO1.
What is the InChIKey of 2H-oxet-2-yl 2-methylprop-2-enoate?
The InChIKey is IJBHCCJNJFUUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-5(2)7(8)10-6-3-4-9-6/h3-4,6H,1H2,2H3.
What are the key properties of 2H-oxet-2-yl 2-methylprop-2-enoate?
2H-oxet-2-yl 2-methylprop-2-enoate has a molecular weight of 140.14 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-oxet-2-yl 2-methylprop-2-enoate is sourced from PubChem (CID 172735399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).