About (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one
(dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one (PubChem CID 70269515) has the molecular formula C14H21NO5
and a molecular weight of 283.32 g/mol. Its IUPAC name is (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one.
Molecular Properties
| Compound Name | (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one |
| PubChem CID | 70269515 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one |
| SMILES | C=C(C)C(=O)OCN(C)C.C=CC1C=COC(O)C1=O |
| InChI | InChI=1S/C7H13NO2.C7H8O3/c1-6(2)7(9)10-5-8(3)4;1-2-5-3-4-10-7(9)6(5)8/h1,5H2,2-4H3;2-5,7,9H,1H2 |
| InChIKey | JGTGXTVSZHUBOV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one?
The IUPAC name of (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one (CID 70269515) is (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one.
What is the SMILES notation for (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one?
The canonical SMILES for (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one is C=C(C)C(=O)OCN(C)C.C=CC1C=COC(O)C1=O.
What is the InChIKey of (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one?
The InChIKey is JGTGXTVSZHUBOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C7H8O3/c1-6(2)7(9)10-5-8(3)4;1-2-5-3-4-10-7(9)6(5)8/h1,5H2,2-4H3;2-5,7,9H,1H2.
What are the key properties of (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one?
(dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one has a molecular weight of 283.32 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (dimethylamino)methyl 2-methylprop-2-enoate;4-ethenyl-2-hydroxy-4H-pyran-3-one is sourced from PubChem (CID 70269515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).