C25H21FN6O3 — CID 59461884
7-N-[(1S)-5-acetyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 59461884) has the molecular formula C25H21FN6O3 and a molecular weight of 472.48 g/mol. Its IUPAC name is 7-N-[(1S)-5-acetyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[(1S)-5-acetyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 59461884 |
| Molecular Formula | C25H21FN6O3 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 7-N-[(1S)-5-acetyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | CC(=O)c1ccc2c(c1)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(F)cc2)nc2ncnn12 |
| InChI | InChI=1S/C25H21FN6O3/c1-14(33)16-4-8-19-17(10-16)5-9-20(19)30-24(35)22-11-21(31-25-28-13-29-32(22)25)23(34)27-12-15-2-6-18(26)7-3-15/h2-4,6-8,10-11,13,20H,5,9,12H2,1H3,(H,27,34)(H,30,35)/t20-/m0/s1 |
| InChIKey | LPBALOXWJWTRMI-FQEVSTJZSA-N |
| XLogP | 2.81 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |