C26H23FN6O3 — CID 59461920
7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 59461920) has the molecular formula C26H23FN6O3 and a molecular weight of 486.51 g/mol. Its IUPAC name is 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 59461920 |
| Molecular Formula | C26H23FN6O3 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | CC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(F)cc2)nc2ncnn12 |
| InChI | InChI=1S/C26H23FN6O3/c1-14-18(15(2)34)7-8-20-19(14)9-10-21(20)31-25(36)23-11-22(32-26-29-13-30-33(23)26)24(35)28-12-16-3-5-17(27)6-4-16/h3-8,11,13,21H,9-10,12H2,1-2H3,(H,28,35)(H,31,36)/t21-/m0/s1 |
| InChIKey | PZIVALYZYZGQLR-NRFANRHFSA-N |
| XLogP | 3.12 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |