C31H31N7O6 — CID 143344237
prop-2-enyl (1S)-1-[[5-[[4-hydroxy-3-(propanoylamino)phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 143344237) has the molecular formula C31H31N7O6 and a molecular weight of 597.63 g/mol. Its IUPAC name is prop-2-enyl (1S)-1-[[5-[[4-hydroxy-3-(propanoylamino)phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | prop-2-enyl (1S)-1-[[5-[[4-hydroxy-3-(propanoylamino)phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 143344237 |
| Molecular Formula | C31H31N7O6 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | prop-2-enyl (1S)-1-[[5-[[4-hydroxy-3-(propanoylamino)phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(O)c(NC(=O)CC)c2)nc2ncnn12 |
| InChI | InChI=1S/C31H31N7O6/c1-4-12-44-30(43)20-7-8-21-19(17(20)3)9-10-22(21)36-29(42)25-14-24(37-31-33-16-34-38(25)31)28(41)32-15-18-6-11-26(39)23(13-18)35-27(40)5-2/h4,6-8,11,13-14,16,22,39H,1,5,9-10,12,15H2,2-3H3,(H,32,41)(H,35,40)(H,36,42)/t22-/m0/s1 |
| InChIKey | JPJPLURCUPFXKT-QFIPXVFZSA-N |
| XLogP | 3.18 |
| TPSA | 176.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|