C28H27FN6O3 — CID 59461260
7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3-ethyl-4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 59461260) has the molecular formula C28H27FN6O3 and a molecular weight of 514.56 g/mol. Its IUPAC name is 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3-ethyl-4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3-ethyl-4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 59461260 |
| Molecular Formula | C28H27FN6O3 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3-ethyl-4-fluorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | CCc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4c3ccc(C(C)=O)c4C)n3ncnc3n2)ccc1F |
| InChI | InChI=1S/C28H27FN6O3/c1-4-18-11-17(5-9-22(18)29)13-30-26(37)24-12-25(35-28(34-24)31-14-32-35)27(38)33-23-10-8-20-15(2)19(16(3)36)6-7-21(20)23/h5-7,9,11-12,14,23H,4,8,10,13H2,1-3H3,(H,30,37)(H,33,38)/t23-/m0/s1 |
| InChIKey | GDXPDPSMDLMFFY-QHCPKHFHSA-N |
| XLogP | 3.68 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |