C30H31N9O4 — CID 70320194
prop-2-enyl (1S)-1-[[5-[[3-[(diaminomethylideneamino)methyl]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 70320194) has the molecular formula C30H31N9O4 and a molecular weight of 581.64 g/mol. Its IUPAC name is prop-2-enyl (1S)-1-[[5-[[3-[(diaminomethylideneamino)methyl]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | prop-2-enyl (1S)-1-[[5-[[3-[(diaminomethylideneamino)methyl]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 70320194 |
| Molecular Formula | C30H31N9O4 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | prop-2-enyl (1S)-1-[[5-[[3-[(diaminomethylideneamino)methyl]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2cccc(CN=C(N)N)c2)nc2ncnn12 |
| InChI | InChI=1S/C30H31N9O4/c1-3-11-43-28(42)21-7-8-22-20(17(21)2)9-10-23(22)37-27(41)25-13-24(38-30-35-16-36-39(25)30)26(40)33-14-18-5-4-6-19(12-18)15-34-29(31)32/h3-8,12-13,16,23H,1,9-11,14-15H2,2H3,(H,33,40)(H,37,41)(H4,31,32,34)/t23-/m0/s1 |
| InChIKey | OJIJCZCLNFKELI-QHCPKHFHSA-N |
| XLogP | 1.90 |
| TPSA | 191.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|