C18H15ClF2N2O — CID 59463487
(2Z)-1-(4-chlorophenyl)-2-[(Z)-1-(2,4-difluorophenyl)propan-2-ylidenehydrazinylidene]propan-1-one (PubChem CID 59463487) has the molecular formula C18H15ClF2N2O and a molecular weight of 348.78 g/mol. Its IUPAC name is (2Z)-1-(4-chlorophenyl)-2-[(Z)-1-(2,4-difluorophenyl)propan-2-ylidenehydrazinylidene]propan-1-one.
| Compound Name | (2Z)-1-(4-chlorophenyl)-2-[(Z)-1-(2,4-difluorophenyl)propan-2-ylidenehydrazinylidene]propan-1-one |
|---|---|
| PubChem CID | 59463487 |
| Molecular Formula | C18H15ClF2N2O |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2Z)-1-(4-chlorophenyl)-2-[(Z)-1-(2,4-difluorophenyl)propan-2-ylidenehydrazinylidene]propan-1-one |
| SMILES | C/C(Cc1ccc(F)cc1F)=N/N=C(/C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClF2N2O/c1-11(9-14-5-8-16(20)10-17(14)21)22-23-12(2)18(24)13-3-6-15(19)7-4-13/h3-8,10H,9H2,1-2H3/b22-11-,23-12- |
| InChIKey | QLYFDZGOXMFAOF-IHKZTNIUSA-N |
| XLogP | 4.88 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|