C28H30Cl2N4O2 — CID 59464401
N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4,5,6,7-tetrahydroindazole-7-carboxamide (PubChem CID 59464401) has the molecular formula C28H30Cl2N4O2 and a molecular weight of 525.48 g/mol. Its IUPAC name is N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4,5,6,7-tetrahydroindazole-7-carboxamide.
| Compound Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4,5,6,7-tetrahydroindazole-7-carboxamide |
|---|---|
| PubChem CID | 59464401 |
| Molecular Formula | C28H30Cl2N4O2 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4,5,6,7-tetrahydroindazole-7-carboxamide |
| SMILES | COc1ccc(-c2c3c(nn2-c2ccc(Cl)cc2Cl)C(C(=O)NN2CC4CCCC4C2)CCC3)cc1 |
| InChI | InChI=1S/C28H30Cl2N4O2/c1-36-21-11-8-17(9-12-21)27-22-6-3-7-23(28(35)32-33-15-18-4-2-5-19(18)16-33)26(22)31-34(27)25-13-10-20(29)14-24(25)30/h8-14,18-19,23H,2-7,15-16H2,1H3,(H,32,35) |
| InChIKey | IZNXVNCQHRLENY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |