C12H17F2O3S- — CID 59471131
2-(1-adamantyl)-1,1-difluoroethanesulfonate (PubChem CID 59471131) has the molecular formula C12H17F2O3S- and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,1-difluoroethanesulfonate.
| Compound Name | 2-(1-adamantyl)-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 59471131 |
| Molecular Formula | C12H17F2O3S- |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(1-adamantyl)-1,1-difluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H18F2O3S/c13-12(14,18(15,16)17)7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7H2,(H,15,16,17)/p-1 |
| InChIKey | YTXODUSNZHROFH-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|