C12H18F2O3S — CID 23082524
2-(2-adamantyl)-1,1-difluoroethanesulfonic acid (PubChem CID 23082524) has the molecular formula C12H18F2O3S and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-(2-adamantyl)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(2-adamantyl)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 23082524 |
| Molecular Formula | C12H18F2O3S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-(2-adamantyl)-1,1-difluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)CC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H18F2O3S/c13-12(14,18(15,16)17)6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-11H,1-6H2,(H,15,16,17) |
| InChIKey | JSYQVFKBBXKUJB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|