C12H18F2O2S — CID 68787321
2-(1-adamantyl)-1,1-difluoroethanesulfinic acid (PubChem CID 68787321) has the molecular formula C12H18F2O2S and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,1-difluoroethanesulfinic acid.
| Compound Name | 2-(1-adamantyl)-1,1-difluoroethanesulfinic acid |
|---|---|
| PubChem CID | 68787321 |
| Molecular Formula | C12H18F2O2S |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(1-adamantyl)-1,1-difluoroethanesulfinic acid |
| SMILES | O=S(O)C(F)(F)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H18F2O2S/c13-12(14,17(15)16)7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7H2,(H,15,16) |
| InChIKey | GXSYUBUQUHPKRZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|