C12H15F4O3S- — CID 59850818
2-(2-adamantyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 59850818) has the molecular formula C12H15F4O3S- and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-(2-adamantyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2-(2-adamantyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 59850818 |
| Molecular Formula | C12H15F4O3S- |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-(2-adamantyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H16F4O3S/c13-11(14,12(15,16)20(17,18)19)10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2,(H,17,18,19)/p-1 |
| InChIKey | VZPWXICCZIIIHT-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|